About 2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate
2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate (PubChem CID 142769948) has the molecular formula C12H20O5S
and a molecular weight of 276.35 g/mol. Its IUPAC name is 2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate.
Molecular Properties
| Compound Name | 2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate |
| PubChem CID | 142769948 |
| Molecular Formula | C12H20O5S |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate |
| SMILES | CC(OC(=O)OC1CCCCC1)C(=O)OCCS |
| InChI | InChI=1S/C12H20O5S/c1-9(11(13)15-7-8-18)16-12(14)17-10-5-3-2-4-6-10/h9-10,18H,2-8H2,1H3 |
| InChIKey | UAYZMZSCBSQUER-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate?
The IUPAC name of 2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate (CID 142769948) is 2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate.
What is the SMILES notation for 2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate?
The canonical SMILES for 2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate is CC(OC(=O)OC1CCCCC1)C(=O)OCCS.
What is the InChIKey of 2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate?
The InChIKey is UAYZMZSCBSQUER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O5S/c1-9(11(13)15-7-8-18)16-12(14)17-10-5-3-2-4-6-10/h9-10,18H,2-8H2,1H3.
What are the key properties of 2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate?
2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate has a molecular weight of 276.35 g/mol, XLogP of 2.33, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylethyl 2-cyclohexyloxycarbonyloxypropanoate is sourced from PubChem (CID 142769948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).