C17H32O6S3 — CID 159056372
2,3-bis(sulfanyl)propyl 2-(2-methoxyethoxy)acetate;cyclohexyl 3-sulfanylpropanoate (PubChem CID 159056372) has the molecular formula C17H32O6S3 and a molecular weight of 428.64 g/mol. Its IUPAC name is 2,3-bis(sulfanyl)propyl 2-(2-methoxyethoxy)acetate;cyclohexyl 3-sulfanylpropanoate.
| Compound Name | 2,3-bis(sulfanyl)propyl 2-(2-methoxyethoxy)acetate;cyclohexyl 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 159056372 |
| Molecular Formula | C17H32O6S3 |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2,3-bis(sulfanyl)propyl 2-(2-methoxyethoxy)acetate;cyclohexyl 3-sulfanylpropanoate |
| SMILES | COCCOCC(=O)OCC(S)CS.O=C(CCS)OC1CCCCC1 |
| InChI | InChI=1S/C9H16O2S.C8H16O4S2/c10-9(6-7-12)11-8-4-2-1-3-5-8;1-10-2-3-11-5-8(9)12-4-7(14)6-13/h8,12H,1-7H2;7,13-14H,2-6H2,1H3 |
| InChIKey | JXXHORYGFATXSI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|