C12H22O8S2 — CID 21118791
[(2R,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-(3-sulfanylpropanoyloxy)hexyl] 3-sulfanylpropanoate (PubChem CID 21118791) has the molecular formula C12H22O8S2 and a molecular weight of 358.43 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-(3-sulfanylpropanoyloxy)hexyl] 3-sulfanylpropanoate.
| Compound Name | [(2R,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-(3-sulfanylpropanoyloxy)hexyl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 21118791 |
| Molecular Formula | C12H22O8S2 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | [(2R,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-(3-sulfanylpropanoyloxy)hexyl] 3-sulfanylpropanoate |
| SMILES | O=C(CCS)OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)COC(=O)CCS |
| InChI | InChI=1S/C12H22O8S2/c13-7(5-19-9(15)1-3-21)11(17)12(18)8(14)6-20-10(16)2-4-22/h7-8,11-14,17-18,21-22H,1-6H2/t7-,8+,11-,12-/m1/s1 |
| InChIKey | LQOOOJZQVCKCNK-IWXIMVSXSA-N |
| XLogP | -1.84 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|