C17H28O8S4 — CID 139373145
[3,4-bis(3-sulfanylpropanoyloxy)-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate (PubChem CID 139373145) has the molecular formula C17H28O8S4 and a molecular weight of 488.67 g/mol. Its IUPAC name is [3,4-bis(3-sulfanylpropanoyloxy)-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate.
| Compound Name | [3,4-bis(3-sulfanylpropanoyloxy)-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 139373145 |
| Molecular Formula | C17H28O8S4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | [3,4-bis(3-sulfanylpropanoyloxy)-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate |
| SMILES | O=C(CCS)OCC(COC(=O)CCS)C(COC(=O)CCS)OC(=O)CCS |
| InChI | InChI=1S/C17H28O8S4/c18-14(1-5-26)22-9-12(10-23-15(19)2-6-27)13(25-17(21)4-8-29)11-24-16(20)3-7-28/h12-13,26-29H,1-11H2 |
| InChIKey | HCMHECAAIYZPSR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|