About 1-aminopentane-1,5-dithiol;hydroiodide
1-aminopentane-1,5-dithiol;hydroiodide (PubChem CID 175503451) has the molecular formula C5H14INS2
and a molecular weight of 279.21 g/mol. Its IUPAC name is 1-aminopentane-1,5-dithiol;hydroiodide.
Molecular Properties
| Compound Name | 1-aminopentane-1,5-dithiol;hydroiodide |
| PubChem CID | 175503451 |
| Molecular Formula | C5H14INS2 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 278.96 |
| IUPAC Name | 1-aminopentane-1,5-dithiol;hydroiodide |
| SMILES | I.NC(S)CCCCS |
| InChI | InChI=1S/C5H13NS2.HI/c6-5(8)3-1-2-4-7;/h5,7-8H,1-4,6H2;1H |
| InChIKey | MQXLODOWPIQADF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopentane-1,5-dithiol;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopentane-1,5-dithiol;hydroiodide?
The IUPAC name of 1-aminopentane-1,5-dithiol;hydroiodide (CID 175503451) is 1-aminopentane-1,5-dithiol;hydroiodide.
What is the SMILES notation for 1-aminopentane-1,5-dithiol;hydroiodide?
The canonical SMILES for 1-aminopentane-1,5-dithiol;hydroiodide is I.NC(S)CCCCS.
What is the InChIKey of 1-aminopentane-1,5-dithiol;hydroiodide?
The InChIKey is MQXLODOWPIQADF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NS2.HI/c6-5(8)3-1-2-4-7;/h5,7-8H,1-4,6H2;1H.
What are the key properties of 1-aminopentane-1,5-dithiol;hydroiodide?
1-aminopentane-1,5-dithiol;hydroiodide has a molecular weight of 279.21 g/mol, XLogP of 1.92, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopentane-1,5-dithiol;hydroiodide is sourced from PubChem (CID 175503451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).