C9H20S6 — CID 57193124
nonane-1,2,3,4,5,9-hexathiol (PubChem CID 57193124) has the molecular formula C9H20S6 and a molecular weight of 320.66 g/mol. Its IUPAC name is nonane-1,2,3,4,5,9-hexathiol.
| Compound Name | nonane-1,2,3,4,5,9-hexathiol |
|---|---|
| PubChem CID | 57193124 |
| Molecular Formula | C9H20S6 |
| Molecular Weight | 320.66 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | nonane-1,2,3,4,5,9-hexathiol |
| SMILES | SCCCCC(S)C(S)C(S)C(S)CS |
| InChI | InChI=1S/C9H20S6/c10-4-2-1-3-6(12)8(14)9(15)7(13)5-11/h6-15H,1-5H2 |
| InChIKey | WBLKBTONSSOEKJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.66 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|