C17H36S7 — CID 175417967
7,9-bis(sulfanylmethyl)pentadecane-1,5,8,11,15-pentathiol (PubChem CID 175417967) has the molecular formula C17H36S7 and a molecular weight of 464.94 g/mol. Its IUPAC name is 7,9-bis(sulfanylmethyl)pentadecane-1,5,8,11,15-pentathiol.
| Compound Name | 7,9-bis(sulfanylmethyl)pentadecane-1,5,8,11,15-pentathiol |
|---|---|
| PubChem CID | 175417967 |
| Molecular Formula | C17H36S7 |
| Molecular Weight | 464.94 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 7,9-bis(sulfanylmethyl)pentadecane-1,5,8,11,15-pentathiol |
| SMILES | SCCCCC(S)CC(CS)C(S)C(CS)CC(S)CCCCS |
| InChI | InChI=1S/C17H36S7/c18-7-3-1-5-15(22)9-13(11-20)17(24)14(12-21)10-16(23)6-2-4-8-19/h13-24H,1-12H2 |
| InChIKey | IKOLAYKRPNANEO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.94 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|