C16H34S6 — CID 141367685
(4R,11S)-4,11-bis(sulfanylmethyl)tetradecane-3,6,9,12-tetrathiol (PubChem CID 141367685) has the molecular formula C16H34S6 and a molecular weight of 418.85 g/mol. Its IUPAC name is (4R,11S)-4,11-bis(sulfanylmethyl)tetradecane-3,6,9,12-tetrathiol.
| Compound Name | (4R,11S)-4,11-bis(sulfanylmethyl)tetradecane-3,6,9,12-tetrathiol |
|---|---|
| PubChem CID | 141367685 |
| Molecular Formula | C16H34S6 |
| Molecular Weight | 418.85 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | (4R,11S)-4,11-bis(sulfanylmethyl)tetradecane-3,6,9,12-tetrathiol |
| SMILES | CCC(S)[C@H](CS)CC(S)CCC(S)C[C@H](CS)C(S)CC |
| InChI | InChI=1S/C16H34S6/c1-3-15(21)11(9-17)7-13(19)5-6-14(20)8-12(10-18)16(22)4-2/h11-22H,3-10H2,1-2H3/t11-,12+,13?,14?,15?,16? |
| InChIKey | QSTMCYXVBWFHCH-LHMJXJFVSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.85 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|