C9H21NS4 — CID 175508393
4-(aminomethyl)octane-1,3,6,8-tetrathiol (PubChem CID 175508393) has the molecular formula C9H21NS4 and a molecular weight of 271.54 g/mol. Its IUPAC name is 4-(aminomethyl)octane-1,3,6,8-tetrathiol.
| Compound Name | 4-(aminomethyl)octane-1,3,6,8-tetrathiol |
|---|---|
| PubChem CID | 175508393 |
| Molecular Formula | C9H21NS4 |
| Molecular Weight | 271.54 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 4-(aminomethyl)octane-1,3,6,8-tetrathiol |
| SMILES | NCC(CC(S)CCS)C(S)CCS |
| InChI | InChI=1S/C9H21NS4/c10-6-7(9(14)2-4-12)5-8(13)1-3-11/h7-9,11-14H,1-6,10H2 |
| InChIKey | YFIKKPPMIAQMNH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.54 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|