About 7-aminoheptane-1,3-dithiol
7-aminoheptane-1,3-dithiol (PubChem CID 167040747) has the molecular formula C7H17NS2
and a molecular weight of 179.35 g/mol. Its IUPAC name is 7-aminoheptane-1,3-dithiol.
Molecular Properties
| Compound Name | 7-aminoheptane-1,3-dithiol |
| PubChem CID | 167040747 |
| Molecular Formula | C7H17NS2 |
| Molecular Weight | 179.35 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 7-aminoheptane-1,3-dithiol |
| SMILES | NCCCCC(S)CCS |
| InChI | InChI=1S/C7H17NS2/c8-5-2-1-3-7(10)4-6-9/h7,9-10H,1-6,8H2 |
| InChIKey | LNAXTINJHJNFDP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 7-aminoheptane-1,3-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-aminoheptane-1,3-dithiol?
The IUPAC name of 7-aminoheptane-1,3-dithiol (CID 167040747) is 7-aminoheptane-1,3-dithiol.
What is the SMILES notation for 7-aminoheptane-1,3-dithiol?
The canonical SMILES for 7-aminoheptane-1,3-dithiol is NCCCCC(S)CCS.
What is the InChIKey of 7-aminoheptane-1,3-dithiol?
The InChIKey is LNAXTINJHJNFDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NS2/c8-5-2-1-3-7(10)4-6-9/h7,9-10H,1-6,8H2.
What are the key properties of 7-aminoheptane-1,3-dithiol?
7-aminoheptane-1,3-dithiol has a molecular weight of 179.35 g/mol, XLogP of 1.73, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-aminoheptane-1,3-dithiol is sourced from PubChem (CID 167040747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).