About 1-aminopentane-1,5-dithiol;hydrochloride
1-aminopentane-1,5-dithiol;hydrochloride (PubChem CID 175503443) has the molecular formula C5H14ClNS2
and a molecular weight of 187.76 g/mol. Its IUPAC name is 1-aminopentane-1,5-dithiol;hydrochloride.
Molecular Properties
| Compound Name | 1-aminopentane-1,5-dithiol;hydrochloride |
| PubChem CID | 175503443 |
| Molecular Formula | C5H14ClNS2 |
| Molecular Weight | 187.76 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | 1-aminopentane-1,5-dithiol;hydrochloride |
| SMILES | Cl.NC(S)CCCCS |
| InChI | InChI=1S/C5H13NS2.ClH/c6-5(8)3-1-2-4-7;/h5,7-8H,1-4,6H2;1H |
| InChIKey | KBVAILURMRFYKR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.76 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopentane-1,5-dithiol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopentane-1,5-dithiol;hydrochloride?
The IUPAC name of 1-aminopentane-1,5-dithiol;hydrochloride (CID 175503443) is 1-aminopentane-1,5-dithiol;hydrochloride.
What is the SMILES notation for 1-aminopentane-1,5-dithiol;hydrochloride?
The canonical SMILES for 1-aminopentane-1,5-dithiol;hydrochloride is Cl.NC(S)CCCCS.
What is the InChIKey of 1-aminopentane-1,5-dithiol;hydrochloride?
The InChIKey is KBVAILURMRFYKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NS2.ClH/c6-5(8)3-1-2-4-7;/h5,7-8H,1-4,6H2;1H.
What are the key properties of 1-aminopentane-1,5-dithiol;hydrochloride?
1-aminopentane-1,5-dithiol;hydrochloride has a molecular weight of 187.76 g/mol, XLogP of 1.72, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopentane-1,5-dithiol;hydrochloride is sourced from PubChem (CID 175503443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).