About 4-methylpentane-1,1-dithiol
4-methylpentane-1,1-dithiol (PubChem CID 56991660) has the molecular formula C6H14S2
and a molecular weight of 150.31 g/mol. Its IUPAC name is 4-methylpentane-1,1-dithiol.
Molecular Properties
| Compound Name | 4-methylpentane-1,1-dithiol |
| PubChem CID | 56991660 |
| Molecular Formula | C6H14S2 |
| Molecular Weight | 150.31 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 4-methylpentane-1,1-dithiol |
| SMILES | CC(C)CCC(S)S |
| InChI | InChI=1S/C6H14S2/c1-5(2)3-4-6(7)8/h5-8H,3-4H2,1-2H3 |
| InChIKey | VJKFYVHIPDTYQS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentane-1,1-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentane-1,1-dithiol?
The IUPAC name of 4-methylpentane-1,1-dithiol (CID 56991660) is 4-methylpentane-1,1-dithiol.
What is the SMILES notation for 4-methylpentane-1,1-dithiol?
The canonical SMILES for 4-methylpentane-1,1-dithiol is CC(C)CCC(S)S.
What is the InChIKey of 4-methylpentane-1,1-dithiol?
The InChIKey is VJKFYVHIPDTYQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14S2/c1-5(2)3-4-6(7)8/h5-8H,3-4H2,1-2H3.
What are the key properties of 4-methylpentane-1,1-dithiol?
4-methylpentane-1,1-dithiol has a molecular weight of 150.31 g/mol, XLogP of 2.61, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentane-1,1-dithiol is sourced from PubChem (CID 56991660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).