About 3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne
3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne (PubChem CID 176983840) has the molecular formula C18H37N
and a molecular weight of 267.50 g/mol. Its IUPAC name is 3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne.
Molecular Properties
| Compound Name | 3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne |
| PubChem CID | 176983840 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | 3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne |
| SMILES | CC#CCCC(C)C.CCC(CCN(C)C)C(C)C |
| InChI | InChI=1S/C10H23N.C8H14/c1-6-10(9(2)3)7-8-11(4)5;1-4-5-6-7-8(2)3/h9-10H,6-8H2,1-5H3;8H,6-7H2,1-3H3 |
| InChIKey | BLTQDORTHJQIAQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne?
The IUPAC name of 3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne (CID 176983840) is 3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne.
What is the SMILES notation for 3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne?
The canonical SMILES for 3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne is CC#CCCC(C)C.CCC(CCN(C)C)C(C)C.
What is the InChIKey of 3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne?
The InChIKey is BLTQDORTHJQIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N.C8H14/c1-6-10(9(2)3)7-8-11(4)5;1-4-5-6-7-8(2)3/h9-10H,6-8H2,1-5H3;8H,6-7H2,1-3H3.
What are the key properties of 3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne?
3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne has a molecular weight of 267.50 g/mol, XLogP of 5.07, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N,N,4-trimethylpentan-1-amine;6-methylhept-2-yne is sourced from PubChem (CID 176983840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).