About 6,7-dimethylnon-2-yne
6,7-dimethylnon-2-yne (PubChem CID 123813434) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is 6,7-dimethylnon-2-yne.
Molecular Properties
| Compound Name | 6,7-dimethylnon-2-yne |
| PubChem CID | 123813434 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 6,7-dimethylnon-2-yne |
| SMILES | CC#CCCC(C)C(C)CC |
| InChI | InChI=1S/C11H20/c1-5-7-8-9-11(4)10(3)6-2/h10-11H,6,8-9H2,1-4H3 |
| InChIKey | XSESNWYPIQRHBI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethylnon-2-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethylnon-2-yne?
The IUPAC name of 6,7-dimethylnon-2-yne (CID 123813434) is 6,7-dimethylnon-2-yne.
What is the SMILES notation for 6,7-dimethylnon-2-yne?
The canonical SMILES for 6,7-dimethylnon-2-yne is CC#CCCC(C)C(C)CC.
What is the InChIKey of 6,7-dimethylnon-2-yne?
The InChIKey is XSESNWYPIQRHBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20/c1-5-7-8-9-11(4)10(3)6-2/h10-11H,6,8-9H2,1-4H3.
What are the key properties of 6,7-dimethylnon-2-yne?
6,7-dimethylnon-2-yne has a molecular weight of 152.28 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethylnon-2-yne is sourced from PubChem (CID 123813434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).