About 2-ethoxyhept-3-yne
2-ethoxyhept-3-yne (PubChem CID 91390030) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-ethoxyhept-3-yne.
Molecular Properties
| Compound Name | 2-ethoxyhept-3-yne |
| PubChem CID | 91390030 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 2-ethoxyhept-3-yne |
| SMILES | CCCC#CC(C)OCC |
| InChI | InChI=1S/C9H16O/c1-4-6-7-8-9(3)10-5-2/h9H,4-6H2,1-3H3 |
| InChIKey | MEPRHVILMJKGFF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyhept-3-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyhept-3-yne?
The IUPAC name of 2-ethoxyhept-3-yne (CID 91390030) is 2-ethoxyhept-3-yne.
What is the SMILES notation for 2-ethoxyhept-3-yne?
The canonical SMILES for 2-ethoxyhept-3-yne is CCCC#CC(C)OCC.
What is the InChIKey of 2-ethoxyhept-3-yne?
The InChIKey is MEPRHVILMJKGFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O/c1-4-6-7-8-9(3)10-5-2/h9H,4-6H2,1-3H3.
What are the key properties of 2-ethoxyhept-3-yne?
2-ethoxyhept-3-yne has a molecular weight of 140.23 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyhept-3-yne is sourced from PubChem (CID 91390030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).