About chlorogold;bis(triethylphosphanium)
chlorogold;bis(triethylphosphanium) (PubChem CID 88800145) has the molecular formula C12H32AuClP2+2
and a molecular weight of 470.76 g/mol. Its IUPAC name is chlorogold;bis(triethylphosphanium).
Molecular Properties
| Compound Name | chlorogold;bis(triethylphosphanium) |
| PubChem CID | 88800145 |
| Molecular Formula | C12H32AuClP2+2 |
| Molecular Weight | 470.76 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | chlorogold;bis(triethylphosphanium) |
| SMILES | CC[PH+](CC)CC.CC[PH+](CC)CC.Cl[Au] |
| InChI | InChI=1S/2C6H15P.Au.ClH/c2*1-4-7(5-2)6-3;;/h2*4-6H2,1-3H3;;1H/q;;+1;/p+1 |
| InChIKey | NNFSLGOHUTXHFM-UHFFFAOYSA-O |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.76 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chlorogold;bis(triethylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorogold;bis(triethylphosphanium)?
The IUPAC name of chlorogold;bis(triethylphosphanium) (CID 88800145) is chlorogold;bis(triethylphosphanium).
What is the SMILES notation for chlorogold;bis(triethylphosphanium)?
The canonical SMILES for chlorogold;bis(triethylphosphanium) is CC[PH+](CC)CC.CC[PH+](CC)CC.Cl[Au].
What is the InChIKey of chlorogold;bis(triethylphosphanium)?
The InChIKey is NNFSLGOHUTXHFM-UHFFFAOYSA-O. The full InChI is InChI=1S/2C6H15P.Au.ClH/c2*1-4-7(5-2)6-3;;/h2*4-6H2,1-3H3;;1H/q;;+1;/p+1.
What are the key properties of chlorogold;bis(triethylphosphanium)?
chlorogold;bis(triethylphosphanium) has a molecular weight of 470.76 g/mol, XLogP of 5.21, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorogold;bis(triethylphosphanium) is sourced from PubChem (CID 88800145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).