About gold(1+);triethylphosphanium;bromide
gold(1+);triethylphosphanium;bromide (PubChem CID 167377784) has the molecular formula C6H16AuBrP+
and a molecular weight of 396.04 g/mol. Its IUPAC name is gold(1+);triethylphosphanium;bromide.
Molecular Properties
| Compound Name | gold(1+);triethylphosphanium;bromide |
| PubChem CID | 167377784 |
| Molecular Formula | C6H16AuBrP+ |
| Molecular Weight | 396.04 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | gold(1+);triethylphosphanium;bromide |
| SMILES | CC[PH+](CC)CC.[Au+].[Br-] |
| InChI | InChI=1S/C6H15P.Au.BrH/c1-4-7(5-2)6-3;;/h4-6H2,1-3H3;;1H/q;+1; |
| InChIKey | LADKKEQKYUXFLL-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.04 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);triethylphosphanium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);triethylphosphanium;bromide?
The IUPAC name of gold(1+);triethylphosphanium;bromide (CID 167377784) is gold(1+);triethylphosphanium;bromide.
What is the SMILES notation for gold(1+);triethylphosphanium;bromide?
The canonical SMILES for gold(1+);triethylphosphanium;bromide is CC[PH+](CC)CC.[Au+].[Br-].
What is the InChIKey of gold(1+);triethylphosphanium;bromide?
The InChIKey is LADKKEQKYUXFLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15P.Au.BrH/c1-4-7(5-2)6-3;;/h4-6H2,1-3H3;;1H/q;+1;.
What are the key properties of gold(1+);triethylphosphanium;bromide?
gold(1+);triethylphosphanium;bromide has a molecular weight of 396.04 g/mol, XLogP of -0.74, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);triethylphosphanium;bromide is sourced from PubChem (CID 167377784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).