About dibromo(dichloro)platinum;bis(triethylphosphanium)
dibromo(dichloro)platinum;bis(triethylphosphanium) (PubChem CID 6396464) has the molecular formula C12H32Br2Cl2P2Pt+2
and a molecular weight of 664.13 g/mol. Its IUPAC name is dibromo(dichloro)platinum;bis(triethylphosphanium).
Molecular Properties
| Compound Name | dibromo(dichloro)platinum;bis(triethylphosphanium) |
| PubChem CID | 6396464 |
| Molecular Formula | C12H32Br2Cl2P2Pt+2 |
| Molecular Weight | 664.13 g/mol |
| Exact Mass | 660.94 |
| IUPAC Name | dibromo(dichloro)platinum;bis(triethylphosphanium) |
| SMILES | CC[PH+](CC)CC.CC[PH+](CC)CC.Cl[Pt](Cl)(Br)Br |
| InChI | InChI=1S/2C6H15P.2BrH.2ClH.Pt/c2*1-4-7(5-2)6-3;;;;;/h2*4-6H2,1-3H3;4*1H;/q;;;;;;+4/p-2 |
| InChIKey | HVBIMLXEVLWRSR-UHFFFAOYSA-L |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 664.13 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibromo(dichloro)platinum;bis(triethylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromo(dichloro)platinum;bis(triethylphosphanium)?
The IUPAC name of dibromo(dichloro)platinum;bis(triethylphosphanium) (CID 6396464) is dibromo(dichloro)platinum;bis(triethylphosphanium).
What is the SMILES notation for dibromo(dichloro)platinum;bis(triethylphosphanium)?
The canonical SMILES for dibromo(dichloro)platinum;bis(triethylphosphanium) is CC[PH+](CC)CC.CC[PH+](CC)CC.Cl[Pt](Cl)(Br)Br.
What is the InChIKey of dibromo(dichloro)platinum;bis(triethylphosphanium)?
The InChIKey is HVBIMLXEVLWRSR-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H15P.2BrH.2ClH.Pt/c2*1-4-7(5-2)6-3;;;;;/h2*4-6H2,1-3H3;4*1H;/q;;;;;;+4/p-2.
What are the key properties of dibromo(dichloro)platinum;bis(triethylphosphanium)?
dibromo(dichloro)platinum;bis(triethylphosphanium) has a molecular weight of 664.13 g/mol, XLogP of 7.59, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibromo(dichloro)platinum;bis(triethylphosphanium) is sourced from PubChem (CID 6396464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).