sodium triethylphosphanium

C6H16NaP+2 — CID 171776421

IUPACsodium triethylphosphanium
SMILESCC[PH+](CC)CC.[Na+]
InChIInChI=1S/C6H15P.Na/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;/q;+1/p+1
InChIKeyJHYLUMNBQGQTNL-UHFFFAOYSA-O
MW142.16 g/mol
LogP-0.74
Rot. Bonds3

About sodium triethylphosphanium

sodium triethylphosphanium (PubChem CID 171776421) has the molecular formula C6H16NaP+2 and a molecular weight of 142.16 g/mol. Its IUPAC name is sodium triethylphosphanium.

Molecular Properties

Compound Namesodium triethylphosphanium
PubChem CID171776421
Molecular FormulaC6H16NaP+2
Molecular Weight142.16 g/mol
Exact Mass142.09
IUPAC Namesodium triethylphosphanium
SMILESCC[PH+](CC)CC.[Na+]
InChIInChI=1S/C6H15P.Na/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;/q;+1/p+1
InChIKeyJHYLUMNBQGQTNL-UHFFFAOYSA-O
XLogP-0.74
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.16
LogP ≤ 5-0.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze sodium triethylphosphanium with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium triethylphosphanium?
The IUPAC name of sodium triethylphosphanium (CID 171776421) is sodium triethylphosphanium.
What is the SMILES notation for sodium triethylphosphanium?
The canonical SMILES for sodium triethylphosphanium is CC[PH+](CC)CC.[Na+].
What is the InChIKey of sodium triethylphosphanium?
The InChIKey is JHYLUMNBQGQTNL-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H15P.Na/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;/q;+1/p+1.
What are the key properties of sodium triethylphosphanium?
sodium triethylphosphanium has a molecular weight of 142.16 g/mol, XLogP of -0.74, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium triethylphosphanium is sourced from PubChem (CID 171776421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).