About sodium triethylphosphanium
sodium triethylphosphanium (PubChem CID 171776421) has the molecular formula C6H16NaP+2
and a molecular weight of 142.16 g/mol. Its IUPAC name is sodium triethylphosphanium.
Molecular Properties
| Compound Name | sodium triethylphosphanium |
| PubChem CID | 171776421 |
| Molecular Formula | C6H16NaP+2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | sodium triethylphosphanium |
| SMILES | CC[PH+](CC)CC.[Na+] |
| InChI | InChI=1S/C6H15P.Na/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;/q;+1/p+1 |
| InChIKey | JHYLUMNBQGQTNL-UHFFFAOYSA-O |
| XLogP | -0.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium triethylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium triethylphosphanium?
The IUPAC name of sodium triethylphosphanium (CID 171776421) is sodium triethylphosphanium.
What is the SMILES notation for sodium triethylphosphanium?
The canonical SMILES for sodium triethylphosphanium is CC[PH+](CC)CC.[Na+].
What is the InChIKey of sodium triethylphosphanium?
The InChIKey is JHYLUMNBQGQTNL-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H15P.Na/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;/q;+1/p+1.
What are the key properties of sodium triethylphosphanium?
sodium triethylphosphanium has a molecular weight of 142.16 g/mol, XLogP of -0.74, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium triethylphosphanium is sourced from PubChem (CID 171776421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).