C4HF8KO4S — CID 141152926
potassium (2R)-1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate (PubChem CID 141152926) has the molecular formula C4HF8KO4S and a molecular weight of 336.20 g/mol. Its IUPAC name is potassium (2R)-1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate.
| Compound Name | potassium (2R)-1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 141152926 |
| Molecular Formula | C4HF8KO4S |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.91 |
| IUPAC Name | potassium (2R)-1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)[C@@H](F)OC(F)(F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C4H2F8O4S.K/c5-1(2(6,7)17(13,14)15)16-4(11,12)3(8,9)10;/h1H,(H,13,14,15);/q;+1/p-1/t1-;/m0./s1 |
| InChIKey | VNRSMDFCJQLUIR-FPRLAITGSA-M |
| XLogP | -1.40 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|