C2F4K2O6S2 — CID 87397454
dipotassium;1,2,2,2-tetrafluoroethane-1,1-disulfonate (PubChem CID 87397454) has the molecular formula C2F4K2O6S2 and a molecular weight of 338.34 g/mol. Its IUPAC name is dipotassium;1,2,2,2-tetrafluoroethane-1,1-disulfonate.
| Compound Name | dipotassium;1,2,2,2-tetrafluoroethane-1,1-disulfonate |
|---|---|
| PubChem CID | 87397454 |
| Molecular Formula | C2F4K2O6S2 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 337.83 |
| IUPAC Name | dipotassium;1,2,2,2-tetrafluoroethane-1,1-disulfonate |
| SMILES | O=S(=O)([O-])C(F)(C(F)(F)F)S(=O)(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C2H2F4O6S2.2K/c3-1(4,5)2(6,13(7,8)9)14(10,11)12;;/h(H,7,8,9)(H,10,11,12);;/q;2*+1/p-2 |
| InChIKey | JMGDDFPGFHHEKA-UHFFFAOYSA-L |
| XLogP | -6.73 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | -6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|