C26H29F3O6S2 — CID 159160631
1-methoxypropan-2-yl acetate;(4-methylphenyl)-diphenylsulfanium;trifluoromethanesulfonate (PubChem CID 159160631) has the molecular formula C26H29F3O6S2 and a molecular weight of 558.64 g/mol. Its IUPAC name is 1-methoxypropan-2-yl acetate;(4-methylphenyl)-diphenylsulfanium;trifluoromethanesulfonate.
| Compound Name | 1-methoxypropan-2-yl acetate;(4-methylphenyl)-diphenylsulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159160631 |
| Molecular Formula | C26H29F3O6S2 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 1-methoxypropan-2-yl acetate;(4-methylphenyl)-diphenylsulfanium;trifluoromethanesulfonate |
| SMILES | COCC(C)OC(C)=O.Cc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C19H17S.C6H12O3.CHF3O3S/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18;1-5(4-8-3)9-6(2)7;2-1(3,4)8(5,6)7/h2-15H,1H3;5H,4H2,1-3H3;(H,5,6,7)/q+1;;/p-1 |
| InChIKey | KKLCOYYJSWRYSU-UHFFFAOYSA-M |
| XLogP | 5.73 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|