C24H25F2O6S2+ — CID 157187829
[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(2-methoxyethoxy)phenyl]-phenylsulfanium (PubChem CID 157187829) has the molecular formula C24H25F2O6S2+ and a molecular weight of 511.59 g/mol. Its IUPAC name is [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(2-methoxyethoxy)phenyl]-phenylsulfanium.
| Compound Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(2-methoxyethoxy)phenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 157187829 |
| Molecular Formula | C24H25F2O6S2+ |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(2-methoxyethoxy)phenyl]-phenylsulfanium |
| SMILES | COCCOc1ccc([S+](c2ccccc2)c2ccc(OC(C)C(F)(F)S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C24H24F2O6S2/c1-18(24(25,26)34(27,28)29)32-20-10-14-23(15-11-20)33(21-6-4-3-5-7-21)22-12-8-19(9-13-22)31-17-16-30-2/h3-15,18H,16-17H2,1-2H3/p+1 |
| InChIKey | HBIGJXDBUQMXQF-UHFFFAOYSA-O |
| XLogP | 5.06 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|