C27H26F5O6S2+ — CID 158625453
[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-[5-methyl-5-(trifluoromethyl)-1,3-dioxan-2-yl]phenyl]-phenylsulfanium (PubChem CID 158625453) has the molecular formula C27H26F5O6S2+ and a molecular weight of 605.62 g/mol. Its IUPAC name is [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-[5-methyl-5-(trifluoromethyl)-1,3-dioxan-2-yl]phenyl]-phenylsulfanium.
| Compound Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-[5-methyl-5-(trifluoromethyl)-1,3-dioxan-2-yl]phenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 158625453 |
| Molecular Formula | C27H26F5O6S2+ |
| Molecular Weight | 605.62 g/mol |
| Exact Mass | 605.11 |
| IUPAC Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-[5-methyl-5-(trifluoromethyl)-1,3-dioxan-2-yl]phenyl]-phenylsulfanium |
| SMILES | CC(Oc1ccc([S+](c2ccccc2)c2ccc(C3OCC(C)(C(F)(F)F)CO3)cc2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C27H25F5O6S2/c1-18(26(28,29)40(33,34)35)38-20-10-14-23(15-11-20)39(21-6-4-3-5-7-21)22-12-8-19(9-13-22)24-36-16-25(2,17-37-24)27(30,31)32/h3-15,18,24H,16-17H2,1-2H3/p+1 |
| InChIKey | PKOLIOJWXXADCG-UHFFFAOYSA-O |
| XLogP | 6.64 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|