C23H17F3O4S2 — CID 158730785
(2-hydroxynaphthalen-1-yl)-diphenylsulfanium;trifluoromethanesulfonate (PubChem CID 158730785) has the molecular formula C23H17F3O4S2 and a molecular weight of 478.51 g/mol. Its IUPAC name is (2-hydroxynaphthalen-1-yl)-diphenylsulfanium;trifluoromethanesulfonate.
| Compound Name | (2-hydroxynaphthalen-1-yl)-diphenylsulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158730785 |
| Molecular Formula | C23H17F3O4S2 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | (2-hydroxynaphthalen-1-yl)-diphenylsulfanium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.Oc1ccc2ccccc2c1[S+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H16OS.CHF3O3S/c23-21-16-15-17-9-7-8-14-20(17)22(21)24(18-10-3-1-4-11-18)19-12-5-2-6-13-19;2-1(3,4)8(5,6)7/h1-16H;(H,5,6,7) |
| InChIKey | ILBNEKBUHZWUPL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|