C23H21F3IO5S2+ — CID 90933065
[1,1-difluoro-2-(3-iodopropoxy)-2-oxoethyl]sulfonyl-[(2-fluorophenyl)-diphenyl-λ4-sulfanyl]oxidanium (PubChem CID 90933065) has the molecular formula C23H21F3IO5S2+ and a molecular weight of 625.45 g/mol. Its IUPAC name is [1,1-difluoro-2-(3-iodopropoxy)-2-oxoethyl]sulfonyl-[(2-fluorophenyl)-diphenyl-λ4-sulfanyl]oxidanium.
| Compound Name | [1,1-difluoro-2-(3-iodopropoxy)-2-oxoethyl]sulfonyl-[(2-fluorophenyl)-diphenyl-λ4-sulfanyl]oxidanium |
|---|---|
| PubChem CID | 90933065 |
| Molecular Formula | C23H21F3IO5S2+ |
| Molecular Weight | 625.45 g/mol |
| Exact Mass | 624.98 |
| IUPAC Name | [1,1-difluoro-2-(3-iodopropoxy)-2-oxoethyl]sulfonyl-[(2-fluorophenyl)-diphenyl-λ4-sulfanyl]oxidanium |
| SMILES | O=C(OCCCI)C(F)(F)S(=O)(=O)[OH+]S(c1ccccc1)(c1ccccc1)c1ccccc1F |
| InChI | InChI=1S/C23H20F3IO5S2/c24-20-14-7-8-15-21(20)33(18-10-3-1-4-11-18,19-12-5-2-6-13-19)32-34(29,30)23(25,26)22(28)31-17-9-16-27/h1-8,10-15H,9,16-17H2/p+1 |
| InChIKey | DREYEJISFAODOY-UHFFFAOYSA-O |
| XLogP | 6.41 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.45 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|