C28H26F9O6S2+ — CID 123593440
[hydroxy-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-oxo-λ6-sulfanylidene]-[[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenyl-λ4-sulfanyl]oxidanium (PubChem CID 123593440) has the molecular formula C28H26F9O6S2+ and a molecular weight of 693.63 g/mol. Its IUPAC name is [hydroxy-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-oxo-λ6-sulfanylidene]-[[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenyl-λ4-sulfanyl]oxidanium.
| Compound Name | [hydroxy-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-oxo-λ6-sulfanylidene]-[[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenyl-λ4-sulfanyl]oxidanium |
|---|---|
| PubChem CID | 123593440 |
| Molecular Formula | C28H26F9O6S2+ |
| Molecular Weight | 693.63 g/mol |
| Exact Mass | 693.10 |
| IUPAC Name | [hydroxy-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-oxo-λ6-sulfanylidene]-[[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenyl-λ4-sulfanyl]oxidanium |
| SMILES | CC(C)(C)OC(=O)COc1ccc(S([O+]=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25F9O6S2/c1-24(2,3)42-23(38)18-41-19-14-16-22(17-15-19)44(20-10-6-4-7-11-20,21-12-8-5-9-13-21)43-45(39,40)28(36,37)26(31,32)25(29,30)27(33,34)35/h4-17H,18H2,1-3H3/p+1 |
| InChIKey | VTEMSAZNPIWHQK-UHFFFAOYSA-O |
| XLogP | 8.67 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.63 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|