C11H14F3IO4S — CID 173186766
5-(iodomethyl)-2-methoxy-1,3-dimethylbenzene;trifluoromethanesulfonic acid (PubChem CID 173186766) has the molecular formula C11H14F3IO4S and a molecular weight of 426.19 g/mol. Its IUPAC name is 5-(iodomethyl)-2-methoxy-1,3-dimethylbenzene;trifluoromethanesulfonic acid.
| Compound Name | 5-(iodomethyl)-2-methoxy-1,3-dimethylbenzene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 173186766 |
| Molecular Formula | C11H14F3IO4S |
| Molecular Weight | 426.19 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | 5-(iodomethyl)-2-methoxy-1,3-dimethylbenzene;trifluoromethanesulfonic acid |
| SMILES | COc1c(C)cc(CI)cc1C.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H13IO.CHF3O3S/c1-7-4-9(6-11)5-8(2)10(7)12-3;2-1(3,4)8(5,6)7/h4-5H,6H2,1-3H3;(H,5,6,7) |
| InChIKey | PFSDXXUSLVLEAB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.19 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|