C26H26F4O5S2 — CID 87289904
[5,5,6,6-tetrafluoro-6-(triphenyl-λ4-sulfanyl)oxysulfonylhexyl] acetate (PubChem CID 87289904) has the molecular formula C26H26F4O5S2 and a molecular weight of 558.62 g/mol. Its IUPAC name is [5,5,6,6-tetrafluoro-6-(triphenyl-λ4-sulfanyl)oxysulfonylhexyl] acetate.
| Compound Name | [5,5,6,6-tetrafluoro-6-(triphenyl-λ4-sulfanyl)oxysulfonylhexyl] acetate |
|---|---|
| PubChem CID | 87289904 |
| Molecular Formula | C26H26F4O5S2 |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | [5,5,6,6-tetrafluoro-6-(triphenyl-λ4-sulfanyl)oxysulfonylhexyl] acetate |
| SMILES | CC(=O)OCCCCC(F)(F)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26F4O5S2/c1-21(31)34-20-12-11-19-25(27,28)26(29,30)37(32,33)35-36(22-13-5-2-6-14-22,23-15-7-3-8-16-23)24-17-9-4-10-18-24/h2-10,13-18H,11-12,19-20H2,1H3 |
| InChIKey | OHLBJRSVUVSSLU-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|