C11H18ClF3O5S — CID 174608505
3-[5-(chloromethyl)heptoxy]-1,1,1-trifluoro-3-oxopropane-2-sulfonic acid (PubChem CID 174608505) has the molecular formula C11H18ClF3O5S and a molecular weight of 354.77 g/mol. Its IUPAC name is 3-[5-(chloromethyl)heptoxy]-1,1,1-trifluoro-3-oxopropane-2-sulfonic acid.
| Compound Name | 3-[5-(chloromethyl)heptoxy]-1,1,1-trifluoro-3-oxopropane-2-sulfonic acid |
|---|---|
| PubChem CID | 174608505 |
| Molecular Formula | C11H18ClF3O5S |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 3-[5-(chloromethyl)heptoxy]-1,1,1-trifluoro-3-oxopropane-2-sulfonic acid |
| SMILES | CCC(CCl)CCCCOC(=O)C(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C11H18ClF3O5S/c1-2-8(7-12)5-3-4-6-20-10(16)9(11(13,14)15)21(17,18)19/h8-9H,2-7H2,1H3,(H,17,18,19) |
| InChIKey | RNSJQWQFGOGWHF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|