C38H47O7PS — CID 91227760
[10-(2,5-dihydroxy-3,4-dimethoxy-6-methylphenyl)dec-9-enyl-triphenyl-λ5-phosphanyl] methanesulfonate (PubChem CID 91227760) has the molecular formula C38H47O7PS and a molecular weight of 678.83 g/mol. Its IUPAC name is [10-(2,5-dihydroxy-3,4-dimethoxy-6-methylphenyl)dec-9-enyl-triphenyl-λ5-phosphanyl] methanesulfonate.
| Compound Name | [10-(2,5-dihydroxy-3,4-dimethoxy-6-methylphenyl)dec-9-enyl-triphenyl-λ5-phosphanyl] methanesulfonate |
|---|---|
| PubChem CID | 91227760 |
| Molecular Formula | C38H47O7PS |
| Molecular Weight | 678.83 g/mol |
| Exact Mass | 678.28 |
| IUPAC Name | [10-(2,5-dihydroxy-3,4-dimethoxy-6-methylphenyl)dec-9-enyl-triphenyl-λ5-phosphanyl] methanesulfonate |
| SMILES | COc1c(O)c(C)c(C=CCCCCCCCCP(OS(C)(=O)=O)(c2ccccc2)(c2ccccc2)c2ccccc2)c(O)c1OC |
| InChI | InChI=1S/C38H47O7PS/c1-30-34(36(40)38(44-3)37(43-2)35(30)39)28-20-9-7-5-6-8-10-21-29-46(45-47(4,41)42,31-22-14-11-15-23-31,32-24-16-12-17-25-32)33-26-18-13-19-27-33/h11-20,22-28,39-40H,5-10,21,29H2,1-4H3 |
| InChIKey | YAWXDFLGULNVIW-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.83 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|