C40H49N3O6 — CID 91931545
(E)-6-(1,4-dihydroxy-3-methylnaphthalen-2-yl)-N-[3-[3-[[(E)-6-(1,4-dihydroxy-3-methylnaphthalen-2-yl)hex-5-enoyl]amino]propylamino]propyl]hex-5-enamide (PubChem CID 91931545) has the molecular formula C40H49N3O6 and a molecular weight of 667.85 g/mol. Its IUPAC name is (E)-6-(1,4-dihydroxy-3-methylnaphthalen-2-yl)-N-[3-[3-[[(E)-6-(1,4-dihydroxy-3-methylnaphthalen-2-yl)hex-5-enoyl]amino]propylamino]propyl]hex-5-enamide.
| Compound Name | (E)-6-(1,4-dihydroxy-3-methylnaphthalen-2-yl)-N-[3-[3-[[(E)-6-(1,4-dihydroxy-3-methylnaphthalen-2-yl)hex-5-enoyl]amino]propylamino]propyl]hex-5-enamide |
|---|---|
| PubChem CID | 91931545 |
| Molecular Formula | C40H49N3O6 |
| Molecular Weight | 667.85 g/mol |
| Exact Mass | 667.36 |
| IUPAC Name | (E)-6-(1,4-dihydroxy-3-methylnaphthalen-2-yl)-N-[3-[3-[[(E)-6-(1,4-dihydroxy-3-methylnaphthalen-2-yl)hex-5-enoyl]amino]propylamino]propyl]hex-5-enamide |
| SMILES | Cc1c(/C=C/CCCC(=O)NCCCNCCCNC(=O)CCC/C=C/c2c(C)c(O)c3ccccc3c2O)c(O)c2ccccc2c1O |
| InChI | InChI=1S/C40H49N3O6/c1-27-29(39(48)33-19-11-9-17-31(33)37(27)46)15-5-3-7-21-35(44)42-25-13-23-41-24-14-26-43-36(45)22-8-4-6-16-30-28(2)38(47)32-18-10-12-20-34(32)40(30)49/h5-6,9-12,15-20,41,46-49H,3-4,7-8,13-14,21-26H2,1-2H3,(H,42,44)(H,43,45)/b15-5+,16-6+ |
| InChIKey | RRXBIHWLRZYNDJ-IAGONARPSA-N |
| XLogP | 7.10 |
| TPSA | 151.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.85 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|