C28H42N4O4 — CID 101370520
3-(4-hydroxyphenyl)-N-[3-[4-[3-[3-(4-hydroxyphenyl)propanoylamino]propylamino]butylamino]propyl]propanamide (PubChem CID 101370520) has the molecular formula C28H42N4O4 and a molecular weight of 498.67 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-N-[3-[4-[3-[3-(4-hydroxyphenyl)propanoylamino]propylamino]butylamino]propyl]propanamide.
| Compound Name | 3-(4-hydroxyphenyl)-N-[3-[4-[3-[3-(4-hydroxyphenyl)propanoylamino]propylamino]butylamino]propyl]propanamide |
|---|---|
| PubChem CID | 101370520 |
| Molecular Formula | C28H42N4O4 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | 3-(4-hydroxyphenyl)-N-[3-[4-[3-[3-(4-hydroxyphenyl)propanoylamino]propylamino]butylamino]propyl]propanamide |
| SMILES | O=C(CCc1ccc(O)cc1)NCCCNCCCCNCCCNC(=O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C28H42N4O4/c33-25-11-5-23(6-12-25)9-15-27(35)31-21-3-19-29-17-1-2-18-30-20-4-22-32-28(36)16-10-24-7-13-26(34)14-8-24/h5-8,11-14,29-30,33-34H,1-4,9-10,15-22H2,(H,31,35)(H,32,36) |
| InChIKey | ZORNFZDYBRPMBS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|