C20H33N3O3 — CID 56967019
N-(6-aminohexyl)-N'-[2-(4-hydroxyphenyl)ethyl]hexanediamide (PubChem CID 56967019) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is N-(6-aminohexyl)-N'-[2-(4-hydroxyphenyl)ethyl]hexanediamide.
| Compound Name | N-(6-aminohexyl)-N'-[2-(4-hydroxyphenyl)ethyl]hexanediamide |
|---|---|
| PubChem CID | 56967019 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | N-(6-aminohexyl)-N'-[2-(4-hydroxyphenyl)ethyl]hexanediamide |
| SMILES | NCCCCCCNC(=O)CCCCC(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C20H33N3O3/c21-14-5-1-2-6-15-22-19(25)7-3-4-8-20(26)23-16-13-17-9-11-18(24)12-10-17/h9-12,24H,1-8,13-16,21H2,(H,22,25)(H,23,26) |
| InChIKey | MPXRGKXJZKRLLM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|