C19H27ClN2O — CID 119732863
7-amino-N-(2-naphthalen-2-ylethyl)heptanamide;hydrochloride (PubChem CID 119732863) has the molecular formula C19H27ClN2O and a molecular weight of 334.89 g/mol. Its IUPAC name is 7-amino-N-(2-naphthalen-2-ylethyl)heptanamide;hydrochloride.
| Compound Name | 7-amino-N-(2-naphthalen-2-ylethyl)heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119732863 |
| Molecular Formula | C19H27ClN2O |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 7-amino-N-(2-naphthalen-2-ylethyl)heptanamide;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)NCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H26N2O.ClH/c20-13-6-2-1-3-9-19(22)21-14-12-16-10-11-17-7-4-5-8-18(17)15-16;/h4-5,7-8,10-11,15H,1-3,6,9,12-14,20H2,(H,21,22);1H |
| InChIKey | YGHPQFZSSOATIC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|