C18H30ClN3O2 — CID 119802950
3-[2-(7-aminoheptanoylamino)ethyl]-N,N-dimethylbenzamide;hydrochloride (PubChem CID 119802950) has the molecular formula C18H30ClN3O2 and a molecular weight of 355.91 g/mol. Its IUPAC name is 3-[2-(7-aminoheptanoylamino)ethyl]-N,N-dimethylbenzamide;hydrochloride.
| Compound Name | 3-[2-(7-aminoheptanoylamino)ethyl]-N,N-dimethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119802950 |
| Molecular Formula | C18H30ClN3O2 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 3-[2-(7-aminoheptanoylamino)ethyl]-N,N-dimethylbenzamide;hydrochloride |
| SMILES | CN(C)C(=O)c1cccc(CCNC(=O)CCCCCCN)c1.Cl |
| InChI | InChI=1S/C18H29N3O2.ClH/c1-21(2)18(23)16-9-7-8-15(14-16)11-13-20-17(22)10-5-3-4-6-12-19;/h7-9,14H,3-6,10-13,19H2,1-2H3,(H,20,22);1H |
| InChIKey | DZGLMBNXOLUSJC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|