C17H22N2O2 — CID 75407728
3-[2-[[(2E,4E)-hexa-2,4-dienoyl]amino]ethyl]-N,N-dimethylbenzamide (PubChem CID 75407728) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-[2-[[(2E,4E)-hexa-2,4-dienoyl]amino]ethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-[[(2E,4E)-hexa-2,4-dienoyl]amino]ethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 75407728 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 3-[2-[[(2E,4E)-hexa-2,4-dienoyl]amino]ethyl]-N,N-dimethylbenzamide |
| SMILES | C/C=C/C=C/C(=O)NCCc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C17H22N2O2/c1-4-5-6-10-16(20)18-12-11-14-8-7-9-15(13-14)17(21)19(2)3/h4-10,13H,11-12H2,1-3H3,(H,18,20)/b5-4+,10-6+ |
| InChIKey | PVAYYLDKHNEIPR-UMCKCUICSA-N |
| XLogP | 2.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|