C16H26N2O2 — CID 65292067
6-amino-N-[2-(4-hydroxyphenyl)ethyl]-4,4-dimethylhexanamide (PubChem CID 65292067) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 6-amino-N-[2-(4-hydroxyphenyl)ethyl]-4,4-dimethylhexanamide.
| Compound Name | 6-amino-N-[2-(4-hydroxyphenyl)ethyl]-4,4-dimethylhexanamide |
|---|---|
| PubChem CID | 65292067 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 6-amino-N-[2-(4-hydroxyphenyl)ethyl]-4,4-dimethylhexanamide |
| SMILES | CC(C)(CCN)CCC(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C16H26N2O2/c1-16(2,10-11-17)9-7-15(20)18-12-8-13-3-5-14(19)6-4-13/h3-6,19H,7-12,17H2,1-2H3,(H,18,20) |
| InChIKey | QXYHHNDKKXSTPR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |