C11H21F3N2O — CID 65291671
6-amino-4,4-dimethyl-N-(3,3,3-trifluoropropyl)hexanamide (PubChem CID 65291671) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is 6-amino-4,4-dimethyl-N-(3,3,3-trifluoropropyl)hexanamide.
| Compound Name | 6-amino-4,4-dimethyl-N-(3,3,3-trifluoropropyl)hexanamide |
|---|---|
| PubChem CID | 65291671 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 6-amino-4,4-dimethyl-N-(3,3,3-trifluoropropyl)hexanamide |
| SMILES | CC(C)(CCN)CCC(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O/c1-10(2,5-7-15)4-3-9(17)16-8-6-11(12,13)14/h3-8,15H2,1-2H3,(H,16,17) |
| InChIKey | HJHZJWJVVYEEGO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |