C14H31N3O — CID 65291456
6-amino-N-[4-(dimethylamino)butyl]-4,4-dimethylhexanamide (PubChem CID 65291456) has the molecular formula C14H31N3O and a molecular weight of 257.42 g/mol. Its IUPAC name is 6-amino-N-[4-(dimethylamino)butyl]-4,4-dimethylhexanamide.
| Compound Name | 6-amino-N-[4-(dimethylamino)butyl]-4,4-dimethylhexanamide |
|---|---|
| PubChem CID | 65291456 |
| Molecular Formula | C14H31N3O |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | 6-amino-N-[4-(dimethylamino)butyl]-4,4-dimethylhexanamide |
| SMILES | CN(C)CCCCNC(=O)CCC(C)(C)CCN |
| InChI | InChI=1S/C14H31N3O/c1-14(2,9-10-15)8-7-13(18)16-11-5-6-12-17(3)4/h5-12,15H2,1-4H3,(H,16,18) |
| InChIKey | HOGYSZRFCZSFKK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|