C21H30O5 — CID 123327838
2-[(E)-10-hydroxydodec-1-en-11-ynyl]-5,6-dimethoxy-3-methylbenzene-1,4-diol (PubChem CID 123327838) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[(E)-10-hydroxydodec-1-en-11-ynyl]-5,6-dimethoxy-3-methylbenzene-1,4-diol.
| Compound Name | 2-[(E)-10-hydroxydodec-1-en-11-ynyl]-5,6-dimethoxy-3-methylbenzene-1,4-diol |
|---|---|
| PubChem CID | 123327838 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-[(E)-10-hydroxydodec-1-en-11-ynyl]-5,6-dimethoxy-3-methylbenzene-1,4-diol |
| SMILES | C#CC(O)CCCCCCC/C=C/c1c(C)c(O)c(OC)c(OC)c1O |
| InChI | InChI=1S/C21H30O5/c1-5-16(22)13-11-9-7-6-8-10-12-14-17-15(2)18(23)20(25-3)21(26-4)19(17)24/h1,12,14,16,22-24H,6-11,13H2,2-4H3/b14-12+ |
| InChIKey | AOKFJUWVKNUEHI-WYMLVPIESA-N |
| XLogP | 4.16 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|