C20H30O6 — CID 123895917
methyl (E)-10-(2,5-dihydroxy-3,4-dimethoxy-6-methylphenyl)dec-9-enoate (PubChem CID 123895917) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is methyl (E)-10-(2,5-dihydroxy-3,4-dimethoxy-6-methylphenyl)dec-9-enoate.
| Compound Name | methyl (E)-10-(2,5-dihydroxy-3,4-dimethoxy-6-methylphenyl)dec-9-enoate |
|---|---|
| PubChem CID | 123895917 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | methyl (E)-10-(2,5-dihydroxy-3,4-dimethoxy-6-methylphenyl)dec-9-enoate |
| SMILES | COC(=O)CCCCCCC/C=C/c1c(C)c(O)c(OC)c(OC)c1O |
| InChI | InChI=1S/C20H30O6/c1-14-15(18(23)20(26-4)19(25-3)17(14)22)12-10-8-6-5-7-9-11-13-16(21)24-2/h10,12,22-23H,5-9,11,13H2,1-4H3/b12-10+ |
| InChIKey | ACCDKBLRCABTST-ZRDIBKRKSA-N |
| XLogP | 4.34 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|