About (3R,6R)-octa-1,7-diyne-3,6-diol
(3R,6R)-octa-1,7-diyne-3,6-diol (PubChem CID 100939656) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is (3R,6R)-octa-1,7-diyne-3,6-diol.
Molecular Properties
| Compound Name | (3R,6R)-octa-1,7-diyne-3,6-diol |
| PubChem CID | 100939656 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | (3R,6R)-octa-1,7-diyne-3,6-diol |
| SMILES | C#C[C@H](O)CC[C@@H](O)C#C |
| InChI | InChI=1S/C8H10O2/c1-3-7(9)5-6-8(10)4-2/h1-2,7-10H,5-6H2/t7-,8-/m0/s1 |
| InChIKey | MUVHJWDYZIZYDQ-YUMQZZPRSA-N |
| XLogP | -0.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R,6R)-octa-1,7-diyne-3,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,6R)-octa-1,7-diyne-3,6-diol?
The IUPAC name of (3R,6R)-octa-1,7-diyne-3,6-diol (CID 100939656) is (3R,6R)-octa-1,7-diyne-3,6-diol.
What is the SMILES notation for (3R,6R)-octa-1,7-diyne-3,6-diol?
The canonical SMILES for (3R,6R)-octa-1,7-diyne-3,6-diol is C#C[C@H](O)CC[C@@H](O)C#C.
What is the InChIKey of (3R,6R)-octa-1,7-diyne-3,6-diol?
The InChIKey is MUVHJWDYZIZYDQ-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H10O2/c1-3-7(9)5-6-8(10)4-2/h1-2,7-10H,5-6H2/t7-,8-/m0/s1.
What are the key properties of (3R,6R)-octa-1,7-diyne-3,6-diol?
(3R,6R)-octa-1,7-diyne-3,6-diol has a molecular weight of 138.17 g/mol, XLogP of -0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6R)-octa-1,7-diyne-3,6-diol is sourced from PubChem (CID 100939656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).