About 5-hydroxyhept-6-ynoate
5-hydroxyhept-6-ynoate (PubChem CID 19074968) has the molecular formula C7H9O3-
and a molecular weight of 141.15 g/mol. Its IUPAC name is 5-hydroxyhept-6-ynoate.
Molecular Properties
| Compound Name | 5-hydroxyhept-6-ynoate |
| PubChem CID | 19074968 |
| Molecular Formula | C7H9O3- |
| Molecular Weight | 141.15 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 5-hydroxyhept-6-ynoate |
| SMILES | C#CC(O)CCCC(=O)[O-] |
| InChI | InChI=1S/C7H10O3/c1-2-6(8)4-3-5-7(9)10/h1,6,8H,3-5H2,(H,9,10)/p-1 |
| InChIKey | RWQMJHDIHSBEHT-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.15 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxyhept-6-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxyhept-6-ynoate?
The IUPAC name of 5-hydroxyhept-6-ynoate (CID 19074968) is 5-hydroxyhept-6-ynoate.
What is the SMILES notation for 5-hydroxyhept-6-ynoate?
The canonical SMILES for 5-hydroxyhept-6-ynoate is C#CC(O)CCCC(=O)[O-].
What is the InChIKey of 5-hydroxyhept-6-ynoate?
The InChIKey is RWQMJHDIHSBEHT-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H10O3/c1-2-6(8)4-3-5-7(9)10/h1,6,8H,3-5H2,(H,9,10)/p-1.
What are the key properties of 5-hydroxyhept-6-ynoate?
5-hydroxyhept-6-ynoate has a molecular weight of 141.15 g/mol, XLogP of -1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxyhept-6-ynoate is sourced from PubChem (CID 19074968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).