C9H12O2 — CID 10534853
(3S,7S)-nona-1,8-diyne-3,7-diol (PubChem CID 10534853) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (3S,7S)-nona-1,8-diyne-3,7-diol.
| Compound Name | (3S,7S)-nona-1,8-diyne-3,7-diol |
|---|---|
| PubChem CID | 10534853 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (3S,7S)-nona-1,8-diyne-3,7-diol |
| SMILES | C#C[C@@H](O)CCC[C@H](O)C#C |
| InChI | InChI=1S/C9H12O2/c1-3-8(10)6-5-7-9(11)4-2/h1-2,8-11H,5-7H2/t8-,9-/m1/s1 |
| InChIKey | PRYHNTHBEFNRGP-RKDXNWHRSA-N |
| XLogP | 0.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|