C12H20OSi — CID 171642288
9-trimethylsilylnona-1,8-diyn-3-ol (PubChem CID 171642288) has the molecular formula C12H20OSi and a molecular weight of 208.38 g/mol. Its IUPAC name is 9-trimethylsilylnona-1,8-diyn-3-ol.
| Compound Name | 9-trimethylsilylnona-1,8-diyn-3-ol |
|---|---|
| PubChem CID | 171642288 |
| Molecular Formula | C12H20OSi |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 9-trimethylsilylnona-1,8-diyn-3-ol |
| SMILES | C#CC(O)CCCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C12H20OSi/c1-5-12(13)10-8-6-7-9-11-14(2,3)4/h1,12-13H,6-8,10H2,2-4H3 |
| InChIKey | IYSDMLXCSOXXCC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|