About 5-propyloct-1-yn-3-ol
5-propyloct-1-yn-3-ol (PubChem CID 175345358) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is 5-propyloct-1-yn-3-ol.
Molecular Properties
| Compound Name | 5-propyloct-1-yn-3-ol |
| PubChem CID | 175345358 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 5-propyloct-1-yn-3-ol |
| SMILES | C#CC(O)CC(CCC)CCC |
| InChI | InChI=1S/C11H20O/c1-4-7-10(8-5-2)9-11(12)6-3/h3,10-12H,4-5,7-9H2,1-2H3 |
| InChIKey | FOVDBRZJPMJAKJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-propyloct-1-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propyloct-1-yn-3-ol?
The IUPAC name of 5-propyloct-1-yn-3-ol (CID 175345358) is 5-propyloct-1-yn-3-ol.
What is the SMILES notation for 5-propyloct-1-yn-3-ol?
The canonical SMILES for 5-propyloct-1-yn-3-ol is C#CC(O)CC(CCC)CCC.
What is the InChIKey of 5-propyloct-1-yn-3-ol?
The InChIKey is FOVDBRZJPMJAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O/c1-4-7-10(8-5-2)9-11(12)6-3/h3,10-12H,4-5,7-9H2,1-2H3.
What are the key properties of 5-propyloct-1-yn-3-ol?
5-propyloct-1-yn-3-ol has a molecular weight of 168.28 g/mol, XLogP of 2.59, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propyloct-1-yn-3-ol is sourced from PubChem (CID 175345358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).