C7H10O2 — CID 72965032
hept-1-en-6-yne-3,5-diol (PubChem CID 72965032) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is hept-1-en-6-yne-3,5-diol.
| Compound Name | hept-1-en-6-yne-3,5-diol |
|---|---|
| PubChem CID | 72965032 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | hept-1-en-6-yne-3,5-diol |
| SMILES | C#CC(O)CC(O)C=C |
| InChI | InChI=1S/C7H10O2/c1-3-6(8)5-7(9)4-2/h1,4,6-9H,2,5H2 |
| InChIKey | AXBXGXIOSZBYLP-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|