C26H42O3 — CID 67329691
(Z)-2-ethyl-2-phenoxyoctadec-9-enoic acid (PubChem CID 67329691) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is (Z)-2-ethyl-2-phenoxyoctadec-9-enoic acid.
| Compound Name | (Z)-2-ethyl-2-phenoxyoctadec-9-enoic acid |
|---|---|
| PubChem CID | 67329691 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | (Z)-2-ethyl-2-phenoxyoctadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCC(CC)(Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H42O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-20-23-26(4-2,25(27)28)29-24-21-18-17-19-22-24/h11-12,17-19,21-22H,3-10,13-16,20,23H2,1-2H3,(H,27,28)/b12-11- |
| InChIKey | LIDIFRLYYPVFEL-QXMHVHEDSA-N |
| XLogP | 7.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|