C13H17F3 — CID 145046793
(5,5,5-trifluoro-4,4-dimethylpentyl)benzene (PubChem CID 145046793) has the molecular formula C13H17F3 and a molecular weight of 230.27 g/mol. Its IUPAC name is (5,5,5-trifluoro-4,4-dimethylpentyl)benzene.
| Compound Name | (5,5,5-trifluoro-4,4-dimethylpentyl)benzene |
|---|---|
| PubChem CID | 145046793 |
| Molecular Formula | C13H17F3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (5,5,5-trifluoro-4,4-dimethylpentyl)benzene |
| SMILES | CC(C)(CCCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H17F3/c1-12(2,13(14,15)16)10-6-9-11-7-4-3-5-8-11/h3-5,7-8H,6,9-10H2,1-2H3 |
| InChIKey | MQXAXTRLJVCFFM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |